CAS 541-01-5
:Hexadecamethylheptasiloxane
Description:
Hexadecamethylheptasiloxane, with the CAS number 541-01-5, is a siloxane compound characterized by a linear structure composed of alternating silicon and oxygen atoms, specifically featuring seven silicon atoms and a total of sixteen methyl groups attached to the silicon atoms. This compound is part of a larger class of organosilicon compounds known for their unique properties, including thermal stability, low surface tension, and hydrophobicity. Hexadecamethylheptasiloxane exhibits low volatility and is generally non-toxic, making it suitable for various applications, including as a lubricant, in cosmetics, and as a surfactant. Its molecular structure contributes to its ability to form films and coatings, enhancing its utility in industrial and consumer products. Additionally, due to its siloxane backbone, it possesses excellent resistance to moisture and chemical degradation, which further broadens its applicability in diverse fields such as materials science and nanotechnology.
Formula:C16H48O6Si7
InChI:InChI=1S/C16H48O6Si7/c1-23(2,3)17-25(7,8)19-27(11,12)21-29(15,16)22-28(13,14)20-26(9,10)18-24(4,5)6/h1-16H3
InChI key:InChIKey=NFVSFLUJRHRSJG-UHFFFAOYSA-N
SMILES:O([Si](O[Si](O[Si](O[Si](C)(C)C)(C)C)(C)C)(C)C)[Si](O[Si](O[Si](C)(C)C)(C)C)(C)C
Synonyms:- 1,1,1,3,3,5,5,7,7,9,9,11,11,13,13,13-Hexadecamethylheptasiloxane
- Heptasiloxane, 1,1,1,3,3,5,5,7,7,9,9,11,11,13,13,13-hexadecamethyl-
- Heptasiloxane, hexadecamethyl-
- Hexadecamethylheptasiloxane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Hexadecamethyl heptasiloxane
CAS:Formula:C16H48O6Si7Purity:96%Color and Shape:LiquidMolecular weight:533.1472Hexadecamethylheptasiloxane
CAS:HexadecamethylheptasiloxaneFormula:C16H48O6Si7Purity:96%Color and Shape: solidMolecular weight:533.15g/molHexadecamethyl heptasiloxane
CAS:<p>S09355 - Hexadecamethyl heptasiloxane</p>Formula:C16H48O6Si7Purity:97%Color and Shape:LiquidMolecular weight:533.149Hexadecamethyl heptasiloxane
CAS:<p>Hexadecamethyl heptasiloxane is an antifungal agent that belongs to a group of functional compounds. It is used in cosmetics as a film-forming polymer. Hexadecamethyl heptasiloxane has been shown to be effective against fungi, including Candida albicans and Trichophyton mentagrophytes, and can be used for the treatment of fungal infections. Hexadecamethyl heptasiloxane has also been shown to have anti-inflammatory properties. This effect may be due to its ability to inhibit prostaglandin synthesis by reversibly binding to the enzyme cyclooxygenase.</p>Formula:C16H48O6Si7Purity:Min. 95%Molecular weight:533.15 g/mol



