CAS 541-31-1
:3-Methyl-1-butanethiol
Description:
3-Methyl-1-butanethiol, also known as isobutyl mercaptan, is an organic compound with the molecular formula C5H12S. It is characterized by a thiol functional group (-SH) attached to a branched alkane chain. This compound typically appears as a colorless to pale yellow liquid with a strong, unpleasant odor reminiscent of garlic or skunk, which makes it useful as an odorant in natural gas to detect leaks. It has a relatively low boiling point and is soluble in organic solvents but only slightly soluble in water. The presence of the thiol group imparts distinct chemical properties, including reactivity with oxidizing agents and the ability to form disulfides. 3-Methyl-1-butanethiol is used in various applications, including flavoring agents in the food industry and as a chemical intermediate in organic synthesis. Due to its strong odor, it is also studied for its potential effects on human health and environmental impact. Proper handling and storage are essential due to its volatility and potential irritant properties.
Formula:C5H12S
InChI:InChI=1S/C5H12S/c1-5(2)3-4-6/h5-6H,3-4H2,1-2H3
InChI key:InChIKey=GIJGXNFNUUFEGH-UHFFFAOYSA-N
SMILES:C(C(C)C)CS
Synonyms:- 1-Butanethiol, 3-methyl-
- 2-Methyl-4-butanethiol
- 3-Methylbutan-1-thiol
- 3-Methylbutane-1-Thiol
- 3-Methylbutanethiol
- 3-Methylbutyl mercaptan
- Isoamyl mercaptan
- Isoamyl sulfhydrate
- Isopentanethiol
- Isopentyl mercaptan
- Isopentylthiol
- iso-Amyl mercaptan
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Isoamyl Mercaptan
CAS:Formula:C5H12SPurity:>94.0%(T)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:104.213-Methyl-1-butanethiol
CAS:Controlled ProductFormula:C5H12SColor and Shape:NeatMolecular weight:104.213-methylbutane-1-thiol
CAS:Formula:C5H12SPurity:94.0%Color and Shape:No data available.Molecular weight:104.213-Methyl-1-butanethiol
CAS:3-Methyl-1-butanethiol is a chemical compound that belongs to the class of sulfonic acids. It has been shown to be an effective inhibitor of the formation of sulfonated compounds in urine samples. 3-Methyl-1-butanethiol also possesses a hydroxyl group and chlorine atom, which are responsible for its inhibitory effects on the polymerization initiator. The hydroxyl group is involved in the synthesis of 3-methyl-1-butanol and 3,3′,5′-trimethylhexane by reacting with methanol and ethylene oxide respectively. The chlorine atom acts as a nucleophile in the reaction with sodium chloride to form chloroacetic acid. This chemical compound also contains a divalent magnesium ion that can act as a cocatalyst for polymerization reactions.Formula:C5H12SPurity:Min. 95%Molecular weight:104.21 g/mol




