CAS 541-35-5
:Butyramide
Description:
Butyramide, with the CAS number 541-35-5, is an organic compound characterized by its amide functional group attached to a butyric acid backbone. It appears as a colorless to pale yellow liquid or solid, depending on temperature and purity. Butyramide is soluble in water and polar organic solvents, which is typical for amides due to their ability to form hydrogen bonds. The compound has a relatively low melting point and boiling point compared to larger amides, reflecting its smaller molecular size. Butyramide is known for its use in organic synthesis and as a potential intermediate in the production of pharmaceuticals and agrochemicals. Its chemical structure allows it to participate in various reactions, including acylation and amidation. Additionally, butyramide exhibits properties that may influence biological activity, making it of interest in biochemical research. Safety data indicates that, like many amides, it should be handled with care, as it may cause irritation upon contact with skin or eyes.
Formula:C4H9NO
InChI:InChI=1S/C4H9NO/c1-2-3-4(5)6/h2-3H2,1H3,(H2,5,6)
InChI key:InChIKey=DNSISZSEWVHGLH-UHFFFAOYSA-N
SMILES:C(C(N)=O)CC
Synonyms:- Busyramide
- Butanamide
- Butanimidic acid
- Butyramide
- NSC 8424
- n-Butylamide
- n-Butyramide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Butyramide
CAS:Formula:C4H9NOPurity:>98.0%(GC)(N)Color and Shape:White to Almost white powder to crystalMolecular weight:87.12Butyramide, 98%
CAS:Butyramide was used in the synthesis of hydroxamic acids, electrorheological fluids and -amodoorganotin compounds. It was used as substrate of (+)--lactamase to develop a microreactor to study enzyme stability, activity, kinetics and substrate specificity. This Thermo Scientific Chemicals brand prod
Formula:C4H9NOPurity:98%Color and Shape:White to cream, Crystals or powder or crystalline powder or flakesMolecular weight:87.12Butyramide
CAS:Formula:C4H9NOPurity:98.0 - 102.0 %Color and Shape:Colourless crystals or white to off-white crystalline powderMolecular weight:87.12Butyramide
CAS:Butyramide is a fatty amide widely used in biochemical experiments and drug synthesis research.
Formula:C4H9NOPurity:98.75%Color and Shape:SolidMolecular weight:87.12







