CAS 54109-15-8

2-bromo-1-(2,4,6-trimethoxyphenyl)ethanone

Description:

2-bromo-1-(2,4,6-trimethoxyphenyl)ethanone is an organic compound characterized by its bromine and ketone functional groups, along with a substituted aromatic ring. The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and polarity. The 2,4,6-trimethoxyphenyl group indicates that the compound has three methoxy (-OCH3) substituents on the aromatic ring, enhancing its electron-donating properties and potentially affecting its solubility and reactivity in various chemical environments. This compound is likely to exhibit moderate to high lipophilicity due to the presence of the aromatic system and methoxy groups, which can also participate in hydrogen bonding. Its structure suggests potential applications in organic synthesis, medicinal chemistry, or as an intermediate in the production of more complex molecules. As with many brominated compounds, it may also exhibit interesting biological activities, making it a subject of interest in pharmacological research. Safety and handling precautions should be observed due to the presence of bromine and the potential for reactivity.

Formula: C₁₁H₁₃BrO₄

InChI: InChI=1/C11H13BrO4/c1-14-7-4-9(15-2)11(8(13)6-12)10(5-7)16-3/h4-5H,6H2,1-3H3

SMILES: COc1cc(c(C(=O)CBr)c(c1)OC)OC

Synonyms:

• Ethanone, 2-bromo-1-(2,4,6-trimethoxyphenyl)-

2,4,6-Trimethoxyphenacyl bromide

CAS: 54109-15-8

2,4,6-Trimethoxyphenacyl bromide

Purity: ≥95%

Molecular weight: 289.12g/mol

Ref: 54-OR400646