CAS 54109-16-9
:2-bromo-1-[2-(trifluoromethyl)phenyl]-1-ethanone
Description:
2-bromo-1-[2-(trifluoromethyl)phenyl]-1-ethanone, with the CAS number 54109-16-9, is an organic compound characterized by its unique molecular structure, which includes a bromine atom and a trifluoromethyl group attached to a phenyl ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its reactivity due to the presence of the carbonyl group (ketone) and the halogen substituent, which can participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. The trifluoromethyl group enhances the compound's lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry and agrochemical applications. Additionally, the presence of bromine may impart specific properties such as increased stability or altered solubility in organic solvents. Safety precautions should be observed when handling this compound, as it may pose health risks due to its halogenated nature.
Formula:C9H6BrF3O
InChI:InChI=1/C9H6BrF3O/c10-5-8(14)6-3-1-2-4-7(6)9(11,12)13/h1-4H,5H2
SMILES:c1ccc(c(c1)C(=O)CBr)C(F)(F)F
Synonyms:- 2-(Trifluoromethyl)phenacyl bromide
- 2-Bromo-1-[2-(Trifluoromethyl)Phenyl]Ethanone
- 2-Bromo-2'-(trifluoromethyl)acetophenone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Bromo-2'-(trifluoromethyl)acetophenone, 97%
CAS:<p>The sulfonyl urea thus obtained was used directly in the following condensation with 4-(trifluoromethyl)phenacyl bromide. Upon heating, benzenesulfinic acid ammonium salt might react with 2-(trifluoromethyl)phenacyl bromide to give -keto sulfone. In Rap-Stoermer condensation reation. This Thermo Sci</p>Formula:C9H6BrF3OPurity:97%Color and Shape:Fused solid, White to yellowMolecular weight:267.052-(Trifluoromethyl)phenacyl bromide
CAS:Formula:C9H6BrF3OPurity:95%Color and Shape:LiquidMolecular weight:267.04252-(Trifluoromethyl)phenacyl bromide
CAS:2-(Trifluoromethyl)phenacyl bromideFormula:C9H6BrF3OPurity:≥95%Color and Shape: clear. colourless liquidMolecular weight:267.04g/mol2-Bromo-2'-(trifluoromethyl)acetophenone
CAS:Formula:C9H6BrF3OPurity:>98.0%(GC)Color and Shape:White or Colorless to Light yellow to Light orange powder to lump to clear liquidMolecular weight:267.052-(Trifluoromethyl)phenacyl bromide
CAS:Formula:C9H6BrF3OPurity:95%Color and Shape:Low Melting SolidMolecular weight:267.045




