CAS 5411-11-0

[4-chloro-5-methyl-2-(propan-2-yl)phenoxy]acetate

Description:

[4-chloro-5-methyl-2-(propan-2-yl)phenoxy]acetate, with the CAS number 5411-11-0, is an organic compound that belongs to the class of phenoxyacetates. This substance features a phenolic structure substituted with a chlorine atom, a methyl group, and an isopropyl group, contributing to its unique chemical properties. It is typically characterized by its moderate solubility in organic solvents and limited solubility in water, which is common for many phenoxy compounds. The presence of the chlorine atom enhances its reactivity and may influence its biological activity, making it of interest in various applications, including agrochemicals and pharmaceuticals. The compound may exhibit herbicidal properties, as many phenoxy derivatives are known for their use in weed control. Additionally, its molecular structure suggests potential interactions with biological systems, warranting further investigation into its environmental impact and safety profile. As with all chemical substances, proper handling and safety precautions are essential when working with this compound.

Formula: C₁₂H₁₄ClO₃

InChI: InChI=1/C12H15ClO3/c1-7(2)9-5-10(13)8(3)4-11(9)16-6-12(14)15/h4-5,7H,6H2,1-3H3,(H,14,15)/p-1

SMILES: CC(C)c1cc(c(C)cc1OCC(=O)[O-])Cl

2-[4-Chloro-5-methyl-2-(propan-2-yl)phenoxy]acetic acid

CAS: 5411-11-0

Versatile small molecule scaffold

Formula: C₁₂H₁₅ClO₃

Purity: Min. 95%

Molecular weight: 242.7 g/mol

Ref: 3D-FAA41111