CAS 5411-64-3

2-[(9-oxo-9H-fluoren-2-yl)carbamoyl]benzoic acid

Description:

2-[(9-oxo-9H-fluoren-2-yl)carbamoyl]benzoic acid, with the CAS number 5411-64-3, is an organic compound characterized by its complex structure, which includes a fluorenone moiety and a benzoic acid functional group. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in organic solvents, depending on the specific conditions. It features both carbonyl and carboxylic acid functional groups, which can participate in hydrogen bonding and contribute to its reactivity and potential applications in organic synthesis or medicinal chemistry. The presence of the fluorenone structure may impart unique optical properties, making it of interest in materials science and photochemistry. Additionally, its ability to form derivatives through various chemical reactions enhances its utility in research and development. Overall, this compound's characteristics make it a valuable subject of study in various fields, including pharmaceuticals and organic materials.

Formula: C₂₁H₁₃NO₄

InChI: InChI=1/C21H13NO4/c23-19-15-6-2-1-5-13(15)14-10-9-12(11-18(14)19)22-20(24)16-7-3-4-8-17(16)21(25)26/h1-11H,(H,22,24)(H,25,26)

SMILES: c1ccc2c(c1)c1ccc(cc1C2=O)N=C(c1ccccc1C(=O)O)O

NSC12404

CAS: 5411-64-3

NSC-12404 is a selective non-lipid LPA2/3 agonist.

Formula: C₂₁H₁₃NO₄

Color and Shape: Solid

Molecular weight: 343.33

Ref: TM-T25885