CAS 54113-41-6

methyl 4,5-dibromofuran-2-carboxylate

Description:

Methyl 4,5-dibromofuran-2-carboxylate is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing oxygen. The presence of two bromine substituents at the 4 and 5 positions of the furan ring significantly influences its chemical reactivity and physical properties. The carboxylate group, esterified with a methyl group, contributes to its solubility in organic solvents and its potential reactivity in various chemical reactions, such as nucleophilic substitutions. This compound is typically used in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its unique structural features that allow for further functionalization. Additionally, the bromine atoms can serve as leaving groups or sites for further substitution reactions. Safety data indicates that, like many brominated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, methyl 4,5-dibromofuran-2-carboxylate is a versatile intermediate in chemical synthesis.

Formula: C₆H₄Br₂O₃

InChI: InChI=1/C6H4Br2O3/c1-10-6(9)4-2-3(7)5(8)11-4/h2H,1H3

SMILES: COC(=O)c1cc(c(Br)o1)Br

Methyl 4,5-Dibromo-2-furancarboxylate

CAS: 54113-41-6

Formula: C₆H₄Br₂O₃

Purity: >95.0%(GC)

Color and Shape: White to Light yellow powder to crystal

Molecular weight: 283.90

Ref: 3B-M2876

Methyl 4,5-dibromo-2-furoate

CAS: 54113-41-6

Formula: C₆H₄Br₂O₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 283.9022

Ref: IN-DA003RU5

Methyl 4,5-dibromo-2-furoate

CAS: 54113-41-6

Methyl 4,5-dibromo-2-furoate

Formula: C₆H₄Br₂O₃

Purity: 98%

Color and Shape: solid

Molecular weight: 283.90g/mol

Ref: 54-OR916713

Methyl 4,5-dibromo-2-furoate

CAS: 54113-41-6

Formula: C₆H₄Br₂O₃

Purity: 96%

Color and Shape: Liquid

Molecular weight: 283.903

Ref: 10-F220199