CAS 54118-66-0
:Benzenemethanol, α-phenyl-α-[3-(1-pyrrolidinyl)-1-propynyl]-, phosphate (1:1) (salt)
Description:
Benzenemethanol, α-phenyl-α-[3-(1-pyrrolidinyl)-1-propynyl]-, phosphate (1:1) (salt), with the CAS number 54118-66-0, is a chemical compound that features a complex structure combining a benzenemethanol moiety with a pyrrolidine and propynyl group, linked through a phosphate group. This compound is characterized by its potential biological activity, often studied in the context of pharmacology and medicinal chemistry. It may exhibit properties such as being a central nervous system stimulant or having effects on neurotransmitter systems, although specific biological activities can vary based on the context of use. The presence of the phosphate group suggests potential solubility in polar solvents and may influence its reactivity and stability. Additionally, the compound's structure indicates it may participate in various chemical reactions typical of phosphates, such as hydrolysis or esterification. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or reactivity. Further research is necessary to fully elucidate its properties and applications.
Formula:C20H21NO·H3O4P
InChI:InChI=1S/C20H21NO.H3O4P/c22-20(18-10-3-1-4-11-18,19-12-5-2-6-13-19)14-9-17-21-15-7-8-16-21;1-5(2,3)4/h1-6,10-13,22H,7-8,15-17H2;(H3,1,2,3,4)
InChI key:InChIKey=KJRDQHIYWCTNTN-UHFFFAOYSA-N
SMILES:P(=O)(O)(O)O.C(C#CCN1CCCC1)(O)(C2=CC=CC=C2)C3=CC=CC=C3
Synonyms:- 1-(4-hydroxy-4,4-diphenylbut-2-yn-1-yl)-3,4-dihydro-2H-pyrrolium dihydrogen phosphate
- Benzenemethanol, α-phenyl-α-[3-(1-pyrrolidinyl)-1-propynyl]-, phosphate (1:1) (salt)
- Butinoline phosphate
- Unii-Eb2657Yybg
- 1-(4-Hydroxy-4,4-diphenylbut-2-ynyl)pyrrolidinium dihydrogen phosphate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Butinoline Phosphate
CAS:Controlled ProductFormula:C20H21NO·H3O4PColor and Shape:NeatMolecular weight:389.382
