CAS 5412-17-9
:2-(undecan-6-yl)pyridine
Description:
2-(Undecan-6-yl)pyridine, with the CAS number 5412-17-9, is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features a long aliphatic chain, specifically an undecyl group, attached to the second position of the pyridine ring. The presence of the nitrogen atom in the pyridine structure imparts basic properties, allowing it to participate in various chemical reactions, such as nucleophilic substitutions. The undecyl chain contributes to the hydrophobic character of the molecule, influencing its solubility and interaction with other substances. Typically, compounds like 2-(undecan-6-yl)pyridine are studied for their potential applications in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. Its physical properties, such as boiling point, melting point, and solubility, can vary based on the length of the aliphatic chain and the presence of functional groups. Overall, this compound exemplifies the interplay between aromatic and aliphatic characteristics in organic chemistry.
Formula:C16H27N
InChI:InChI=1/C16H27N/c1-3-5-7-11-15(12-8-6-4-2)16-13-9-10-14-17-16/h9-10,13-15H,3-8,11-12H2,1-2H3
SMILES:CCCCCC(CCCCC)c1ccccn1
Synonyms:- Pyridine, 2-(1-pentylhexyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
