CAS 54123-06-7
:2-chloro-4-(2-chlorophenyl)-9-methyl-6H-thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepine
Description:
2-Chloro-4-(2-chlorophenyl)-9-methyl-6H-thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepine is a complex organic compound characterized by its unique bicyclic structure that incorporates both a thieno and a diazepine moiety. This compound features multiple functional groups, including chloro and methyl substituents, which can influence its chemical reactivity and biological activity. The presence of the triazole ring contributes to its potential pharmacological properties, making it of interest in medicinal chemistry. Typically, compounds of this nature may exhibit a range of biological activities, including anti-inflammatory, anticonvulsant, or anxiolytic effects, although specific activity would depend on further empirical studies. The molecular structure suggests potential interactions with various biological targets, which could be explored for therapeutic applications. Additionally, the compound's solubility, stability, and reactivity would be influenced by its substituents and overall molecular geometry, making it a candidate for further research in drug development and synthesis.
Formula:C15H10Cl2N4S
InChI:InChI=1/C15H10Cl2N4S/c1-8-19-20-13-7-18-14(9-4-2-3-5-11(9)16)10-6-12(17)22-15(10)21(8)13/h2-6H,7H2,1H3
Synonyms:- 6H-Thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepine, 2-chloro-4-(2-chlorophenyl)-9-methyl-
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Clotizolam
CAS:<p>Clotizolam is a thienotriazolodiazepine derivative with PAF antagonistic properties, exhibiting sedative, anxiolytic, anticonvulsant, and muscle relaxant effects.</p>Formula:C15H10Cl2N4SColor and Shape:SolidMolecular weight:349.24
