CAS 5413-80-9

1H-pyrazolo[3,4-d]pyrimidine-4,6-diamine

Description:

1H-pyrazolo[3,4-d]pyrimidine-4,6-diamine, with the CAS number 5413-80-9, is a heterocyclic compound characterized by a fused pyrazole and pyrimidine ring system. This compound features two amino groups at the 4 and 6 positions of the pyrimidine ring, contributing to its potential as a building block in medicinal chemistry. It is typically a crystalline solid, exhibiting moderate solubility in polar solvents. The presence of the amino groups allows for hydrogen bonding, which can enhance its reactivity and interaction with biological targets. This compound has garnered interest for its potential applications in pharmaceuticals, particularly as a scaffold for developing kinase inhibitors and other therapeutic agents. Its unique structure may also impart specific electronic properties, making it suitable for various chemical reactions. Overall, 1H-pyrazolo[3,4-d]pyrimidine-4,6-diamine is a versatile compound with significant implications in drug discovery and development.

Formula: C₅H₆N₆

InChI: InChI=1/C5H6N6/c6-3-2-1-8-11-4(2)10-5(7)9-3/h1H,(H5,6,7,8,9,10,11)

SMILES: c1c2c(=N)[nH]c(=N)nc2[nH][nH]1

1H-Pyrazolo[3,4-d]pyrimidine-4,6-diamine (9CI)

CAS: 5413-80-9

Formula: C₅H₆N₆

Purity: 95%

Color and Shape: Solid

Molecular weight: 150.1413

Ref: IN-DA00DBSS

1H-PYRAZOLO[3,4-D]PYRIMIDINE-4,6-DIAMINE

CAS: 5413-80-9

Purity: 95%

Molecular weight: 150.1450043

Ref: 10-F827056