CAS 5413-88-7

1-methyl-4-nitro-1H-imidazole-5-carboxamide

Description:

1-Methyl-4-nitro-1H-imidazole-5-carboxamide, with the CAS number 5413-88-7, is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a methyl group and a nitro group, which contribute to its reactivity and potential biological activity. The carboxamide functional group enhances its solubility in polar solvents and may influence its interaction with biological targets. Typically, compounds of this nature are studied for their pharmacological properties, including antimicrobial and antifungal activities. The presence of the nitro group often indicates potential for redox reactions, while the imidazole moiety is known for its role in enzyme catalysis and as a building block in various pharmaceuticals. Overall, 1-methyl-4-nitro-1H-imidazole-5-carboxamide is of interest in medicinal chemistry and may serve as a lead compound for further development in drug discovery.

Formula: C₅H₆N₄O₃

InChI: InChI=1/C5H6N4O3/c1-8-2-7-5(9(11)12)3(8)4(6)10/h2H,1H3,(H2,6,10)

SMILES: Cn1cnc(c1C(=O)N)N(=O)=O

1-Methyl-4-nitro-1H-imidazole-5-carboxamide

Controlled Product

CAS: 5413-88-7

Applications A substituted imidazolothiazole derivative as possible antiparasitic agents.
References Sarasin, J., et al.: Helv. Chim. Acta, 7, 713 (1924),

Formula: C₅H₆N₄O₃

Color and Shape: Neat

Molecular weight: 170.13

Ref: TR-M323745