CAS 5413-96-7

6-chloro-1-methyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine

Description:

6-Chloro-1-methyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine is a heterocyclic organic compound characterized by its pyrazolo-pyrimidine structure, which features a fused ring system containing both pyrazole and pyrimidine moieties. The presence of a chlorine atom at the 6-position and a methyl group at the 1-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and is soluble in polar organic solvents. It exhibits potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The amine functional group at the 4-position can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Its molecular structure allows for interactions with biological targets, which may lead to therapeutic applications. As with many heterocycles, the compound's reactivity and stability can be influenced by the electronic effects of the substituents, making it a subject of study in both synthetic and medicinal chemistry.

Formula: C₆H₆ClN₅

InChI: InChI=1/C6H6ClN5/c1-12-5-3(2-9-12)4(8)10-6(7)11-5/h2H,1H3,(H2,8,10,11)

SMILES: Cn1c2c(cn1)c(N)nc(Cl)n2

6-Chloro-1-methyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine

CAS: 5413-96-7

6-Chloro-1-methyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine

Purity: 97%

Molecular weight: 183.60g/mol

Ref: 54-OR954203

6-Chloro-1-methyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine

CAS: 5413-96-7

Purity: >95%

Molecular weight: 183.598

Ref: FT-C12955

6-chloro-1-methyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine

CAS: 5413-96-7

Formula: C₆H₆ClN₅

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 183.6

Ref: 10-F330501

4-Chloro-1,6-dimethyl-1H-pyrazolo[3,4-d]pyrimidine

CAS: 5413-96-7

Versatile small molecule scaffold

Formula: C₇H₇ClN₄

Purity: Min. 95%

Molecular weight: 182.61 g/mol

Ref: 3D-FAA41396