CAS 5414-01-7

6-chloro-N,1-diphenyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine

Description:

6-Chloro-N,1-diphenyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine is a chemical compound characterized by its complex heterocyclic structure, which includes a pyrazolo-pyrimidine framework. This compound features a chlorine atom at the 6-position and two phenyl groups attached to the nitrogen atom at the 1-position, contributing to its unique chemical properties. It is typically classified as an organic compound and may exhibit biological activity, making it of interest in medicinal chemistry and drug development. The presence of the pyrazolo and pyrimidine rings suggests potential interactions with biological targets, possibly influencing enzyme activity or receptor binding. Its molecular structure allows for various chemical reactions, including substitution and coupling, which can be exploited in synthetic chemistry. Additionally, the compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, 6-chloro-N,1-diphenyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine represents a significant compound for research in pharmacology and organic synthesis.

Formula: C₁₇H₁₂ClN₅

InChI: InChI=1/C17H12ClN5/c18-17-21-15(20-12-7-3-1-4-8-12)14-11-19-23(16(14)22-17)13-9-5-2-6-10-13/h1-11H,(H,20,21,22)

SMILES: c1ccc(cc1)Nc1c2cnn(c3ccccc3)c2nc(Cl)n1

Synonyms:

• 1H-pyrazolo[3,4-d]pyrimidin-4-amine, 6-chloro-N,1-diphenyl-
• 6-Chloro-N,1-diphenyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine

6-Chloro-N,1-diphenyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine

CAS: 5414-01-7

Purity: 95.0%

Molecular weight: 321.7699890136719

Ref: 10-F495125