CAS 54141-72-9

2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-3,4-dihydro-2H-chromen-3-yl 6-deoxyhexopyranoside

Description:

The chemical substance known as "2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-3,4-dihydro-2H-chromen-3-yl 6-deoxyhexopyranoside," with the CAS number 54141-72-9, is a flavonoid glycoside. This compound features a chromen-4-one backbone, which is characteristic of flavonoids, and is substituted with multiple hydroxyl groups that contribute to its potential antioxidant properties. The presence of a glycoside moiety indicates that it is a sugar derivative, which can influence its solubility and biological activity. Flavonoids are known for their diverse pharmacological effects, including anti-inflammatory, antimicrobial, and anticancer activities. The specific arrangement of hydroxyl groups and the sugar component can enhance the compound's ability to interact with biological systems, potentially affecting its bioavailability and efficacy. Overall, this compound exemplifies the structural complexity and functional diversity found within flavonoid glycosides, making it a subject of interest in both medicinal chemistry and natural product research.

Formula: C₂₁H₂₂O₁₁

InChI: InChI=1/C21H22O11/c1-7-15(26)17(28)18(29)21(30-7)32-20-16(27)14-12(25)5-9(22)6-13(14)31-19(20)8-2-3-10(23)11(24)4-8/h2-7,15,17-26,28-29H,1H3

SMILES: CC1C(C(C(C(O1)OC1C(=O)c2c(cc(cc2OC1c1ccc(c(c1)O)O)O)O)O)O)O

Neoisoastilbin

CAS: 54141-72-9

Neoisoastilbin

Purity: ≥98%

Molecular weight: 450.39g/mol

Ref: 54-BUP00538

Neoisoastilbin

CAS: 54141-72-9

Formula: C₂₁H₂₂O₁₁

Purity: 95%~99%

Molecular weight: 450.396

Ref: BP-BP4574

Neoisoastilbin

CAS: 54141-72-9

Neoisoastilbin may have antioxidant and anti-inflammatory activities.

Formula: C₂₁H₂₂O₁₁

Purity: 99.71% - 99.85%

Color and Shape: Solid

Molecular weight: 450.39

Ref: TM-TN1983

Neoisoastilbin

CAS: 54141-72-9

Neoisoastilbin is a chemical compound, specifically a flavonoid derivative, derived primarily from natural botanical sources such as certain species of plants. It is characterized by its unique structural configuration which distinguishes it from its closely related isomers. As a flavonoid, Neoisoastilbin acts through multiple biochemical pathways, notably by scavenging free radicals and modulating oxidative stress responses, which can have significant implications in biological systems.Neoisoastilbin's notable applications lie in its potential antioxidant properties, which are of particular interest in the fields of pharmacology and biochemistry. Researchers study its effects on cellular models to understand its role in protecting cells from oxidative damage. It also has potential applications in the development of therapeutic agents aiming to mitigate conditions associated with oxidative stress, such as neurodegenerative diseases or cardiovascular disorders. Investigations into its pharmacodynamics and pharmacokinetics are essential to elucidate its full potential and mechanisms within complex biological systems.

Formula: C₂₁H₂₂O₁₁

Purity: Min. 95%

Molecular weight: 450.39 g/mol

Ref: 3D-FN74537