CAS 54142-77-7

D-lyxo-hexos-2-ulose

Description:

D-lyxo-hexos-2-ulose, also known as D-lyxose, is a sugar acid that belongs to the class of aldoses, specifically a hexose. It is characterized by its six carbon atoms and an aldehyde functional group, which classifies it as an aldohexose. The compound is a stereoisomer of other hexoses, exhibiting specific optical activity due to its chiral centers. D-lyxo-hexos-2-ulose is typically found in a crystalline form and is soluble in water, making it readily available for various biochemical applications. It plays a role in carbohydrate metabolism and can be involved in the synthesis of other biomolecules. The CAS number 54142-77-7 uniquely identifies this compound in chemical databases, facilitating its study and application in research and industry. Its reactivity is influenced by the presence of hydroxyl groups, allowing it to participate in various chemical reactions, including oxidation and reduction processes. Overall, D-lyxo-hexos-2-ulose is significant in both biological systems and synthetic chemistry.

Formula: C₆H₁₀O₆

InChI: InChI=1/C6H10O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,4-6,8,10-12H,2H2/t4-,5-,6+/m1/s1

Synonyms:

• D-lyxo-Hexos-2-ulose

2-Keto-D-galactose

CAS: 54142-77-7

2-Keto-D-galactose inhibits DNA synthesis and inhibits the proliferation of in vitro grown Ehrlich ascites tumor cells.

Formula: C₆H₁₀O₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 178.14

Ref: TM-T13479