CAS 54147-04-5
:1H-Imidazole-4-carboxylic acid, 5-amino-1-methyl-, ethyl ester
Description:
1H-Imidazole-4-carboxylic acid, 5-amino-1-methyl-, ethyl ester, with the CAS number 54147-04-5, is an organic compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a carboxylic acid functional group and an ethyl ester moiety, contributing to its solubility and reactivity. The presence of an amino group enhances its potential for biological activity, making it of interest in pharmaceutical and biochemical research. Typically, compounds like this exhibit moderate polarity due to the combination of hydrophilic (carboxylic acid and amino) and hydrophobic (ethyl ester) groups. Its molecular structure allows for various interactions, including hydrogen bonding, which can influence its behavior in biological systems. Additionally, derivatives of imidazole are often studied for their roles in enzyme catalysis and as building blocks in drug design. Overall, this compound's unique characteristics make it a valuable subject for further investigation in medicinal chemistry and related fields.
Formula:C7H11N3O2
InChI:InChI=1S/C7H11N3O2/c1-3-12-7(11)5-6(8)10(2)4-9-5/h4H,3,8H2,1-2H3
InChI key:InChIKey=SVQAKMGJJNPCMD-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C(N)N(C)C=N1
Synonyms:- Ethyl 5-amino-1-methyl-1H-imidazole-4-carboxylate
- 1H-Imidazole-4-carboxylic acid, 5-amino-1-methyl-, ethyl ester
- Imidazole-4-carboxylic acid, 5-amino-1-methyl-, ethyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1H-Imidazole-4-carboxylic acid, 5-amino-1-methyl-, ethyl ester
CAS:Formula:C7H11N3O2Purity:95%Color and Shape:SolidMolecular weight:169.1811Ethyl 5-amino-1-methyl-1H-imidazole-4-carboxylate
CAS:Ethyl 5-amino-1-methyl-1H-imidazole-4-carboxylatePurity:95%Molecular weight:169.18g/molEthyl 5-amino-1-methyl-1H-imidazole-4-carboxylate
CAS:<p>Ethyl 5-amino-1-methyl-1H-imidazole-4-carboxylate is a synthetic retinoid that has been shown to be effective in the treatment of psoriasis. It inhibits the activation of histone lysine residues and increases the terminal half life of endogenous synthesis. The quantum theory is used to explain its biological properties. Ethyl 5-amino-1-methyl-1H-imidazole-4-carboxylate also inhibits the production of proinflammatory cytokines in response to inflammatory stimuli, and it has been shown to inhibit lipopolysaccharide (LPS) induced production of nitric oxide.</p>Formula:C7H11N3O2Purity:Min. 95%Molecular weight:169.18 g/mol



