CAS 54149-16-5

2-(2-bromoethoxy)propane

Description:

2-(2-Bromoethoxy)propane, with the CAS number 54149-16-5, is an organic compound characterized by its ether functional group and a bromine atom attached to an ethoxy group. This compound features a propane backbone, which contributes to its hydrophobic nature, while the ethoxy group enhances its solubility in organic solvents. The presence of the bromine atom makes it a potential electrophile, allowing it to participate in nucleophilic substitution reactions. Its molecular structure suggests that it may exhibit moderate volatility and a relatively low boiling point compared to larger alkyl ethers. Additionally, the compound may be sensitive to moisture and light, which can lead to hydrolysis or degradation. In terms of safety, like many brominated compounds, it may pose health risks if inhaled or ingested, necessitating proper handling and storage procedures. Overall, 2-(2-bromoethoxy)propane is of interest in organic synthesis and may serve as an intermediate in the production of various chemical products.

Formula: C₅H₁₁BrO

InChI: InChI=1/C5H11BrO/c1-5(2)7-4-3-6/h5H,3-4H2,1-2H3

SMILES: CC(C)OCCBr

2-(2-BROMOETHOXY)PROPANE

CAS: 54149-16-5

Formula: C₅H₁₁BrO

Purity: 97%

Color and Shape: Liquid

Molecular weight: 167.0442

Ref: IN-DA0037AJ

2-(2-Bromoethoxy)propane

CAS: 54149-16-5

2-(2-Bromoethoxy)propane

Purity: 97%

Molecular weight: 167.04g/mol

Ref: 54-OR965620

2-(2-Bromoethoxy)propane

CAS: 54149-16-5

Formula: C₅H₁₁BrO

Purity: 95%

Color and Shape: Liquid

Molecular weight: 167.046

Ref: 10-F238451

2-(2-Bromoethoxy)propane

CAS: 54149-16-5

Versatile small molecule scaffold

Formula: C₅H₁₁BrO

Purity: Min. 95%

Molecular weight: 167.04 g/mol

Ref: 3D-ECA14916