CymitQuimica logo

CAS 5415-62-3

:

3,5,6-Trifluoro-2-nitroaniline

Description:
3,5,6-Trifluoro-2-nitroaniline is an organic compound characterized by the presence of three fluorine atoms, a nitro group, and an amino group attached to a benzene ring. Its molecular structure features a nitro group (-NO2) at the 2-position and trifluoromethyl groups at the 3, 5, and 6 positions of the aniline ring. This compound is typically a solid at room temperature and is known for its potential applications in the synthesis of dyes, pharmaceuticals, and agrochemicals due to its unique electronic properties imparted by the fluorine and nitro substituents. The presence of fluorine enhances the compound's stability and lipophilicity, making it useful in various chemical reactions. Additionally, 3,5,6-Trifluoro-2-nitroaniline may exhibit specific biological activities, which can be of interest in medicinal chemistry. However, handling this compound requires caution due to potential toxicity and environmental concerns associated with fluorinated compounds. Proper safety measures should be observed when working with this substance in laboratory settings.
Formula:C6H3F3N2O2
InChI:InChI=1/C6H3F3N2O2/c7-2-1-3(8)6(11(12)13)5(10)4(2)9/h1H,10H2
InChI key:BQQVOARSGADABE-UHFFFAOYSA-N
SMILES:c1c(c(c(c(c1F)N(=O)=O)N)F)F
Synonyms:
  • 2,3,5-Trifluoro-6-Nitroaniline
Found 4 products.