CAS 54151-52-9

1-(3,4-dihydroisoquinolin-2(1H)-yl)propan-2-amine

Description:

1-(3,4-dihydroisoquinolin-2(1H)-yl)propan-2-amine, with the CAS number 54151-52-9, is a chemical compound that belongs to the class of amines and isoquinolines. It features a propan-2-amine backbone, which is substituted with a 3,4-dihydroisoquinoline moiety. This compound is characterized by its potential biological activity, often studied for its effects on the central nervous system and its possible applications in medicinal chemistry. The presence of the isoquinoline structure contributes to its pharmacological properties, as isoquinolines are known for their diverse biological activities, including antipsychotic and analgesic effects. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its synthesis often involves multi-step organic reactions, and it may be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity. As with many amines, it may also exhibit basic properties, allowing it to form salts with acids.

Formula: C₁₂H₁₈N₂

InChI: InChI=1/C12H18N2/c1-10(13)8-14-7-6-11-4-2-3-5-12(11)9-14/h2-5,10H,6-9,13H2,1H3

SMILES: CC(CN1CCc2ccccc2C1)N

1-(3,4-Dihydroisoquinolin-2(1H)-yl)propan-2-amine

CAS: 54151-52-9

Formula: C₁₂H₁₈N₂

Molecular weight: 190.2847

Ref: IN-DA00DU9Z

1-(3,4-dihydroisoquinolin-2(1H)-yl)propan-2-amine

CAS: 54151-52-9

Formula: C₁₂H₁₈N₂

Purity: 95.0%

Molecular weight: 190.29

Ref: 10-F308080