CAS 541550-19-0: Apilimod
Description:Apilimod, with the CAS number 541550-19-0, is a small molecule that functions primarily as a selective inhibitor of the enzyme phosphoinositide 3-kinase (PI3K). It is known for its immunomodulatory properties, particularly in the context of autoimmune diseases and certain types of cancer. Apilimod has been studied for its ability to inhibit the production of pro-inflammatory cytokines, thereby modulating immune responses. The compound is characterized by its specific binding affinity to the target enzyme, which plays a crucial role in various cellular processes, including cell growth, proliferation, and survival. In terms of its chemical structure, Apilimod contains a pyrimidine core, which is essential for its biological activity. The substance is typically administered in a pharmaceutical context, and its efficacy and safety profiles are evaluated through clinical trials. Overall, Apilimod represents a promising therapeutic agent in the field of immunology and oncology, with ongoing research aimed at elucidating its full potential and mechanisms of action.
Formula:C23H26N6O2
InChI:InChI=1S/C23H26N6O2/c1-18-5-4-6-19(15-18)17-25-28-21-16-22(29-10-13-30-14-11-29)27-23(26-21)31-12-8-20-7-2-3-9-24-20/h2-7,9,15-17H,8,10-14H2,1H3,(H,26,27,28)
InChI key:InChIKey=HSKAZIJJKRAJAV-UHFFFAOYSA-N
SMILES:N(=CC1=CC=CC(=C1)C)NC2=NC(=NC(=C2)N3CCOCC3)OCCC4=NC=CC=C4
- Synonyms:
- Apilimod
- Benzaldehyde, 3-methyl-, [6-(4-morpholinyl)-2-[2-(2-pyridinyl)ethoxy]-4-pyrimidinyl]hydrazone
- Benzaldehyde,3-methyl-, [6-(4-morpholinyl)-2-[2-(2-pyridinyl)ethoxy]-4-pyrimidinyl]hydrazone(9CI)
- Sta 5326
- LAM 002
- Benzaldehyde, 3-methyl-, 2-[6-(4-morpholinyl)-2-[2-(2-pyridinyl)ethoxy]-4-pyrimidinyl]hydrazone
