CAS 5416-70-6

3-(2-methoxyphenyl)-1-phenylprop-2-en-1-one

Description:

3-(2-Methoxyphenyl)-1-phenylprop-2-en-1-one, also known as a type of chalcone, is an organic compound characterized by its conjugated double bond system, which contributes to its reactivity and potential biological activity. This compound features a prop-2-en-1-one backbone, where the presence of the methoxy group on the aromatic ring enhances its electron-donating properties, influencing its chemical behavior. Chalcones are known for their role in various biological activities, including anti-inflammatory, antioxidant, and antimicrobial properties. The structure of this compound allows for potential applications in pharmaceuticals and materials science. Its physical properties, such as solubility and melting point, can vary based on the specific conditions and purity of the sample. Additionally, the compound may exhibit UV-Vis absorption characteristics due to its conjugated system, making it useful in photochemical studies. Overall, 3-(2-methoxyphenyl)-1-phenylprop-2-en-1-one represents a significant class of compounds with diverse applications in chemistry and biology.

Formula: C₁₆H₁₄O₂

InChI: InChI=1/C16H14O2/c1-18-16-10-6-5-9-14(16)11-12-15(17)13-7-3-2-4-8-13/h2-12H,1H3

SMILES: COc1ccccc1C=CC(=O)c1ccccc1

2-Methoxychalcone

CAS: 5416-70-6

2-Methoxychalcone

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 238.28g/mol

Ref: 54-OR27788