CAS 54166-09-5
:6-deoxy-L-arabino-hexos-2-ulose
Description:
6-deoxy-L-arabino-hexos-2-ulose, with the CAS number 54166-09-5, is a carbohydrate derivative characterized by its unique structural features. It is a hexose sugar that lacks a hydroxyl group at the 6th carbon position, which is significant in determining its reactivity and biological function. The molecule contains a ketone functional group at the second carbon, classifying it as a ketose. This compound is part of the broader category of sugars and sugar derivatives, which play crucial roles in various biochemical processes. Its configuration as an L-sugar indicates its specific stereochemistry, which can influence its interaction with enzymes and receptors in biological systems. 6-deoxy-L-arabino-hexos-2-ulose may participate in metabolic pathways and could have implications in research related to carbohydrate chemistry, biochemistry, and potential applications in pharmaceuticals or biotechnology. Understanding its properties, such as solubility, stability, and reactivity, is essential for exploring its potential uses in scientific and industrial contexts.
Formula:C6H10O5
InChI:InChI=1/C6H10O5/c1-3(8)5(10)6(11)4(9)2-7/h2-3,5-6,8,10-11H,1H3/t3-,5-,6-/m0/s1
SMILES:C[C@@H]([C@@H]([C@H](C(=O)C=O)O)O)O
Synonyms:- L-arabino-Hexos-2-ulose, 6-deoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
