CymitQuimica logo

CAS 54166-15-3

:

diethyl 3-(benzyloxy)cyclobutane-1,1-dicarboxylate

Description:
Diethyl 3-(benzyloxy)cyclobutane-1,1-dicarboxylate is an organic compound characterized by its unique structure, which includes a cyclobutane ring substituted with a benzyloxy group and two ester functional groups. The presence of the diethyl ester moieties contributes to its solubility in organic solvents and its potential reactivity in various chemical reactions, such as esterification or hydrolysis. The benzyloxy group enhances the compound's stability and may influence its electronic properties, making it a useful intermediate in organic synthesis. This compound is typically colorless to pale yellow in appearance and may exhibit moderate volatility. Its applications may extend to pharmaceuticals, agrochemicals, or as a building block in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, diethyl 3-(benzyloxy)cyclobutane-1,1-dicarboxylate represents a versatile compound in organic chemistry with potential applications in various fields.
Formula:C17H22O5
InChI:InChI=1/C17H22O5/c1-3-20-15(18)17(16(19)21-4-2)10-14(11-17)22-12-13-8-6-5-7-9-13/h5-9,14H,3-4,10-12H2,1-2H3
InChI key:OSQKNXLJUGYQHW-UHFFFAOYSA-N
SMILES:CCOC(=O)C1(CC(C1)OCC2=CC=CC=C2)C(=O)OCC
Synonyms:
  • Diethyl 3-(benzyloxy)cyclobutane-1,1-dicarboxylate1,1-diethyl 3-(benzyloxy)cyclobutane-1,1-dicarboxylate
Found 3 products.