CAS 5417-82-3
:2-(1-Ethoxyethylidene)propanedinitrile
Description:
2-(1-Ethoxyethylidene)propanedinitrile, with the CAS number 5417-82-3, is an organic compound characterized by its unique structure, which includes a propanedinitrile backbone and an ethoxyethylidene substituent. This compound typically appears as a colorless to pale yellow liquid and is known for its moderate volatility. It is soluble in organic solvents, reflecting its non-polar characteristics, while exhibiting limited solubility in water due to the presence of the nitrile groups. The presence of multiple functional groups, including nitriles, contributes to its reactivity, making it useful in various chemical syntheses and applications. Additionally, the compound may exhibit specific physical properties such as boiling and melting points that are influenced by its molecular structure. Safety data indicates that, like many nitriles, it should be handled with care due to potential toxicity and irritant properties. Overall, 2-(1-Ethoxyethylidene)propanedinitrile is a compound of interest in organic chemistry and materials science.
Formula:C7H8N2O
InChI:InChI=1S/C7H8N2O/c1-3-10-6(2)7(4-8)5-9/h3H2,1-2H3
InChI key:InChIKey=BOSVWXDDFBSSIZ-UHFFFAOYSA-N
SMILES:C(=C(OCC)C)(C#N)C#N
Synonyms:- (1-Ethoxyethylidene)malonitrile
- (1-Ethoxyethylidene)propanedinitrile
- 1-Ethoxyethylidenemalononitrile
- 2-(1-Ethoxyethylidene)malononitrile
- 2-(1-Ethoxyethylidene)propanedinitrile
- 2-Cyano-3-ethoxy-3-methylacrylonitrile
- Brn 0906913
- Malononitrile, (1-ethoxyethylidene)-
- Nsc 11585
- Propanedinitrile, (1-ethoxyethylidene)-
- Propanedinitrile, 2-(1-ethoxyethylidene)-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-(1-Ethoxyethylidene)malononitrile
CAS:<p>2-(1-Ethoxyethylidene)malononitrile</p>Formula:C7H8N2OPurity:98%Color and Shape: off white solidMolecular weight:136.15g/mol(1-Ethoxyethylidene)malononitrile
CAS:Formula:C7H8N2OPurity:95%Color and Shape:SolidMolecular weight:136.154(ethoxyethylidene)methane-1,1-dicarbonitrile
CAS:<p>(EtO)2CCHCN is a chemical compound that has been shown to have anticancer activity. This drug binds to the glutamate receptor subtype and inhibits the binding of glutamate to its receptor, which leads to cell death. The chemical structure of (EtO)2CCHCN is similar to that of adenosine, which also has anticancer properties. In addition, (EtO)2CCHCN has been shown to be a competitive inhibitor for both the A1 adenosine receptor and the NMDA glutamate receptor. (EtO)2CCHCN may be effective in treating depression by inhibiting glutamate-induced excitotoxicity in certain regions of the brain.</p>Formula:C7H8N2OPurity:Min. 95%Molecular weight:136.15 g/mol


