CymitQuimica logo

CAS 54173-39-6

:

1-(3,4,5-Trimethoxy-2-nitrophenyl)ethanone

Description:
1-(3,4,5-Trimethoxy-2-nitrophenyl)ethanone, with the CAS number 54173-39-6, is an organic compound characterized by its complex aromatic structure. It features a phenyl ring substituted with three methoxy groups and a nitro group, which contribute to its chemical reactivity and potential biological activity. The presence of the ethanone functional group indicates that it is a ketone, which can participate in various chemical reactions, including nucleophilic additions. The methoxy groups enhance the compound's solubility in organic solvents and may influence its electronic properties, making it a candidate for applications in organic synthesis and medicinal chemistry. Additionally, the nitro group can impart unique reactivity, potentially allowing for further derivatization. This compound may exhibit interesting pharmacological properties, although specific biological activities would require empirical investigation. Overall, 1-(3,4,5-Trimethoxy-2-nitrophenyl)ethanone represents a versatile structure within the realm of organic chemistry, with implications for both research and application in various fields.
Formula:C11H13NO6
InChI:InChI=1/C11H13NO6/c1-6(13)7-5-8(16-2)10(17-3)11(18-4)9(7)12(14)15/h5H,1-4H3
SMILES:CC(=O)c1cc(c(c(c1N(=O)=O)OC)OC)OC
Synonyms:
  • 3',4',5'-Trimethoxy-2'-nitroacetophenone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.