CAS 5418-63-3: 1,2,3,3-Tetramethyl-3H-indolium iodide
Description:1,2,3,3-Tetramethyl-3H-indolium iodide is a quaternary ammonium compound characterized by its indolium structure, which features a positively charged nitrogen atom within a fused ring system. This compound is typically recognized for its bright color, often appearing as a red or purple solid, due to its conjugated system that allows for significant light absorption. It is soluble in polar solvents, which enhances its utility in various applications, including organic synthesis and as a dye. The presence of the iodide ion contributes to its ionic nature, influencing its solubility and reactivity. Additionally, this compound can exhibit interesting photophysical properties, making it valuable in studies related to fluorescence and photochemistry. Its stability and reactivity can vary depending on the conditions, such as temperature and solvent choice. Overall, 1,2,3,3-Tetramethyl-3H-indolium iodide serves as a useful reagent in chemical research and applications, particularly in the fields of organic chemistry and materials science.
Formula:C12H16N·I
InChI:InChI=1S/C12H16N.HI/c1-9-12(2,3)10-7-5-6-8-11(10)13(9)4;/h5-8H,1-4H3;1H/q+1;/p-1
InChI key:InChIKey=HCYIOKVZAATOEW-UHFFFAOYSA-M
SMILES:[I-].C=1C=CC2=C(C1)[N+](=C(C)C2(C)C)C
- Synonyms:
- 1,2,3,3-Tetramethyl-3H-indol-1-ium iodide
- 1,2,3,3-Tetramethylindolium iodide
- 1,2,3,3-tetramethyl-3H-indolium
- 1-Methyl-2,3,3-trimethyl-3H-indolium
- 2,2,3,4-Tetramethylbenzazolium iodide
- 2,3,3-Trimethyl-3H-indole methiodide
- 3H-Indolium, 1,2,3,3-tetramethyl-, iodide
- 3H-Indolium, 1,2,3,3-tetramethyl-, iodide (1:1)
- Nsc 10498
- 1,2,3,3-Tetramethyl-3H-indolium iodide
- See more synonyms
