CAS 5418-94-0
:2-Chloro-4H-pyrido[1,2-a]pyrimidin-4-one
Description:
2-Chloro-4H-pyrido[1,2-a]pyrimidin-4-one is a heterocyclic compound characterized by its fused pyridine and pyrimidine rings, which contribute to its unique chemical properties. This compound features a chlorine substituent at the 2-position and a carbonyl group at the 4-position of the pyrimidine ring. It is typically a crystalline solid and exhibits moderate solubility in polar organic solvents. The presence of the chlorine atom enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the compound may exhibit biological activity, which has led to interest in its potential applications in pharmaceuticals and agrochemicals. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its behavior in biological systems. Overall, 2-Chloro-4H-pyrido[1,2-a]pyrimidin-4-one is a compound of interest in both synthetic chemistry and medicinal research due to its unique structural features and potential applications.
Formula:C8H5ClN2O
InChI:InChI=1S/C8H5ClN2O/c9-6-5-8(12)11-4-2-1-3-7(11)10-6/h1-5H
InChI key:InChIKey=CGGMQFDVKUHJED-UHFFFAOYSA-N
SMILES:O=C1N2C(=NC(Cl)=C1)C=CC=C2
Synonyms:- 2-Chloropyrido[1,2-a]pyrimidin-4-one
- 4H-Pyrido[1,2-a]pyrimidin-4-one, 2-chloro-
- NSC 10546
- 2-Chloro-4H-pyrido[1,2-a]pyrimidin-4-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-a)pyrimidin-4-one,2-chloro-4h-pyrido(
CAS:Formula:C8H5ClN2OPurity:98%Color and Shape:SolidMolecular weight:180.59112-Chloro-4h-pyrido[1,2-a]pyrimidin-4-one
CAS:2-Chloro-4h-pyrido[1,2-a]pyrimidin-4-onePurity:98%Molecular weight:180.59g/mol2-Chloro-4H-pyrido[1,2-a]pyrimidin-4-one
CAS:Formula:C8H5ClN2OPurity:98%Color and Shape:SolidMolecular weight:180.592-Chloro-4h-pyrido[1,2-a]pyrimidin-4-one
CAS:2-Chloro-4h-pyrido[1,2-a]pyrimidin-4-one is an azido compound that reacts with hydrazine to form a piperidinium salt. The reaction between the azide and hydrazine forms a cyclization product that undergoes nitrosation to form a hydrazone. This molecule can be converted into a cyanoguanidine by reacting it with hydroxylamine. br> br> The 2-chloro-4h-pyrido[1,2-a]pyrimidin-4-one molecule contains both nucleophilic and electrophilic groups. These groups react with each other in the presence of acid or base to produce an alkyl halide or amine respectively. This property makes the molecule useful for many purposes including as an intermediate in organic synthesis and as a precursor to biochemicals such as antibiotics and antihistFormula:C8H5ClN2OPurity:Min. 95%Molecular weight:180.59 g/mol



