CAS 54187-96-1
:1-(chloromethyl)-1H-benzotriazole
Description:
1-(Chloromethyl)-1H-benzotriazole is an organic compound characterized by its benzotriazole structure, which consists of a triazole ring fused to a benzene ring. This compound features a chloromethyl group (-CH2Cl) attached to the nitrogen of the triazole, which enhances its reactivity and potential applications in various chemical processes. It is typically a white to light yellow solid and is soluble in organic solvents. The presence of the chloromethyl group makes it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals, agrochemicals, and other fine chemicals. Additionally, benzotriazole derivatives are known for their applications as corrosion inhibitors and UV stabilizers. Safety considerations should be taken into account when handling this compound, as it may pose health risks due to its chlorinated nature. Proper storage and handling protocols are essential to mitigate any potential hazards associated with exposure.
Formula:C7H6ClN3
InChI:InChI=1/C7H6ClN3/c8-5-11-7-4-2-1-3-6(7)9-10-11/h1-4H,5H2
SMILES:c1ccc2c(c1)nnn2CCl
Synonyms:- Chloromethylbezotriazole
- 1-(Chloromethyl)-1H-bezotriazole
- BUTTPARK 84\02-49
- -benzotriazole
- H
- 1-(Chloromethyl)benzotriazole
- 1-(Chloromethyl)-1
- 1-(CHLOROMETHYL)-1H-BENZOTRIAZOLE 98+%
- 1-(Chloromethyl)-1H-benzotriazole 98%
- 1-(CHLOROMETHYL)-1H-BENZOTRIAZOLE
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-(Chloromethyl)-1H-benzotriazole
CAS:Formula:C7H6ClN3Purity:97%Color and Shape:SolidMolecular weight:167.59561-(Chloromethyl)-1H-benzo[d][1,2,3]triazole
CAS:1-(Chloromethyl)-1H-benzo[d][1,2,3]triazolePurity:98%Molecular weight:167.60g/mol1-(Chloromethyl)-1H-benzotriazole
CAS:Formula:C7H6ClN3Purity:>98.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:167.601-(CHLOROMETHYL)-1H-BENZOTRIAZOLE
CAS:Formula:C7H6ClN3Purity:97%Color and Shape:SolidMolecular weight:167.61-(Chloromethyl)-1H-benzotriazole
CAS:<p>1-Chloromethyl-1H-benzotriazole is a water soluble organometallic compound that has been used in wastewater treatment. It is an active methylene that binds to palladium complexes, which are catalysts for the hydrogenation of organic compounds. The x-ray crystal structures for 1-chloromethyl-1H-benzotriazole show that it can form a coordination complex with palladium(II). This complex is nucleophilic and reacts with chloride to form the corresponding chloro complex. The quaternization of 1-chloromethyl-1H benzotriazole is a reaction where one molecule of hydrogen chloride reacts with the methylene group to produce a tertiary amine, which yields chloride as a byproduct. The structural analysis and NMR spectra confirm the presence of protonated chlorine atoms in the molecule.</p>Formula:C7H6ClN3Purity:Min. 95%Molecular weight:167.6 g/mol




