
CAS 54188-38-4
:Metralindole
Description:
Metralindole, with the CAS number 54188-38-4, is a chemical compound that belongs to the class of indole derivatives. It is characterized by its unique structure, which includes an indole ring fused with a metoxy group, contributing to its potential biological activity. Metralindole is primarily recognized for its applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound exhibits properties that may influence various biological pathways, making it of interest in research related to neuropharmacology and other therapeutic areas. Its solubility, stability, and reactivity can vary depending on the specific conditions and solvents used. As with many chemical substances, safety and handling precautions are essential, as it may pose health risks if not managed properly. Overall, Metralindole represents a significant compound in the study of indole derivatives and their potential applications in drug development.
Formula:C15H17N3O
InChI:InChI=1S/C15H17N3O/c1-17-7-8-18-13-4-3-10(19-2)9-12(13)11-5-6-16-15(17)14(11)18/h3-4,9H,5-8H2,1-2H3
InChI key:InChIKey=GVXBHSBKKJRBMS-UHFFFAOYSA-N
SMILES:CN1C=2C3=C(C=4C(N3CC1)=CC=C(OC)C4)CCN2
Synonyms:- Metralindole
- 1H-3,4,6a-Triazafluoranthene, 2,4,5,6-tetrahydro-9-methoxy-4-methyl-
- 1,2,5,6-Tetrahydro-8-methoxy-3-methyl-3H-pyrazino-[1,2,3-ab]-β-carboline
- 2,4,5,6-Tetrahydro-9-methoxy-4-methyl-1H-3,4,6a-triazafluoranthene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Metralindole
CAS:Metralindole is a reversible inhibitor of monoamine oxidase A (RIMA).Formula:C15H17N3OColor and Shape:SolidMolecular weight:255.32
