CAS 54189-82-1

6-Chloro-N-methylnicotinamide

Description:

6-Chloro-N-methylnicotinamide is a chemical compound characterized by its structural features, which include a chlorinated pyridine ring and a methylnicotinamide moiety. It is derived from nicotinic acid and is known for its potential biological activities, including its role as a pharmacological agent. The presence of the chlorine atom at the 6-position of the pyridine ring can influence its reactivity and interaction with biological targets. This compound is typically a white to off-white solid and is soluble in polar solvents, which facilitates its use in various chemical reactions and biological assays. Its molecular structure allows it to participate in hydrogen bonding and other intermolecular interactions, making it of interest in medicinal chemistry. Additionally, 6-Chloro-N-methylnicotinamide may exhibit properties such as anti-inflammatory or antimicrobial activities, although specific biological effects can vary based on concentration and environmental conditions. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₇H₇ClN₂O

InChI: InChI=1S/C7H7ClN2O/c1-9-7(11)5-2-3-6(8)10-4-5/h2-4H,1H3,(H,9,11)

InChI key: InChIKey=DEYOMDZKXMQLCF-UHFFFAOYSA-N

SMILES: C(NC)(=O)C=1C=CC(Cl)=NC1

Synonyms:

• 2-Chloro-5-N-methylcarbamoylpyridine
• 2-Chloro-N-methyl-5-pyridinecarboxamide
• 3-pyridinecarboxamide, 6-chloro-N-methyl-
• 6-Chloro-N-methyl-3-pyridinecarboxamide
• 6-Chloro-N-methylnicotinamide

6-CHLORO-N-METHYL-NICOTINAMIDE

CAS: 54189-82-1

Formula: C₇H₇ClN₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 170.5963

Ref: IN-DA00DEM5

6-Chloro-N-methylnicotinamide

CAS: 54189-82-1

6-Chloro-N-methylnicotinamide

Purity: 99%

Molecular weight: 170.60g/mol

Ref: 54-OR110281

6-Chloro-N-methylnicotinamide

CAS: 54189-82-1

Formula: C₇H₇ClN₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 170.6

Ref: 10-F337937

6-Chloro-N-methylnicotinamide

CAS: 54189-82-1

6-Chloro-N-methylnicotinamide is an organic molecule with a pyridine ring, an amide group, and a chlorinated methyl group. It is regioselective for the electrophiles cross-coupling reactions with nucleophiles. 6-Chloro-N-methylnicotinamide has been used as an intermediate in the synthesis of carboxamides.

Formula: C₇H₇ClN₂O

Purity: Min. 95%

Molecular weight: 170.6 g/mol

Ref: 3D-ECA18982