CymitQuimica logo

CAS 54191-03-6

:

4-(1a,10b-dihydro-6H-dibenzo[3,4:6,7]cyclohepta[1,2-b]oxiren-6-ylidene)piperidine

Description:
4-(1a,10b-dihydro-6H-dibenzo[3,4:6,7]cyclohepta[1,2-b]oxiren-6-ylidene)piperidine, with the CAS number 54191-03-6, is a complex organic compound characterized by its unique bicyclic structure that incorporates both dibenzo and oxirane functionalities. This compound features a piperidine ring, which is a six-membered nitrogen-containing heterocycle, contributing to its potential biological activity. The presence of the dibenzo structure suggests that it may exhibit interesting electronic properties and could participate in various chemical reactions due to the reactivity of the oxirane moiety. The stereochemistry of the compound, indicated by the specific naming conventions, may influence its interactions and stability. Such compounds are often studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to their structural diversity and ability to interact with biological targets. However, detailed studies on its physical properties, reactivity, and biological activity would be necessary to fully understand its characteristics and potential uses.
Formula:C20H19NO
InChI:InChI=1/C20H19NO/c1-3-7-16-14(5-1)18(13-9-11-21-12-10-13)15-6-2-4-8-17(15)20-19(16)22-20/h1-8,19-21H,9-12H2
SMILES:c1ccc2c(c1)C(=C1CCNCC1)c1ccccc1C1C2O1
Synonyms:
  • Piperidine, 4-(1a,10b-dihydro-6H-dibenzo(3,4:6,7)cyclohept(1,2-b)oxiren-6-ylidene)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.