CAS 54191-04-7
:4-(1a,10b-dihydro-6H-dibenzo[3,4:6,7]cyclohepta[1,2-b]oxiren-6-ylidene)-1-methylpiperidine
Description:
4-(1a,10b-dihydro-6H-dibenzo[3,4:6,7]cyclohepta[1,2-b]oxiren-6-ylidene)-1-methylpiperidine, with CAS number 54191-04-7, is a complex organic compound characterized by its unique bicyclic structure that incorporates both a piperidine ring and a dibenzo-cycloheptene moiety. This compound features a fused bicyclic system, which contributes to its potential biological activity and chemical reactivity. The presence of the oxirane (epoxide) functional group suggests that it may participate in nucleophilic reactions, making it a candidate for further chemical transformations. Its molecular structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the structural motifs that are often associated with bioactive compounds. Additionally, the compound's stereochemistry and functional groups may influence its solubility, stability, and interaction with biological targets. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C21H21NO
InChI:InChI=1/C21H21NO/c1-22-12-10-14(11-13-22)19-15-6-2-4-8-17(15)20-21(23-20)18-9-5-3-7-16(18)19/h2-9,20-21H,10-13H2,1H3
SMILES:CN1CCC(=C2c3ccccc3C3C(c4ccccc24)O3)CC1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Cyproheptadine Impurity 1
CAS:Formula:C21H21NOColor and Shape:Pale Yellow SolidMolecular weight:303.41Cyproheptadine-10,11-epoxide
CAS:Cyproheptadine-10,11-epoxide is an analog with anticancer properties that inhibits protein kinases. This compound has been shown to be effective in inhibiting tumor cell growth and inducing apoptosis in cancer cells. Cyproheptadine-10,11-epoxide is a potent inhibitor of several kinases, including those involved in the regulation of cell proliferation and survival. It has been found in human urine and is considered a potential medicinal agent for the treatment of cancer. This compound has also been studied extensively in Chinese traditional medicine as an inhibitor of tumor growth and proliferation. Overall, cyproheptadine-10,11-epoxide shows great promise as a potential therapeutic option for cancer patients.Formula:C21H21NOPurity:Min. 95%Molecular weight:303.4 g/mol


