CAS 542-07-4
:3-[(Aminocarbonyl)amino]-3-oxopropanoic acid
Description:
3-[(Aminocarbonyl)amino]-3-oxopropanoic acid, also known as L-aspartic acid, is an α-amino acid that plays a crucial role in the biosynthesis of proteins. It is characterized by its two carboxyl groups and one amino group, making it a polar molecule with both acidic and basic properties. This compound is typically found in its zwitterionic form at physiological pH, where it carries both a positive and a negative charge. L-aspartic acid is a non-essential amino acid, meaning that it can be synthesized by the human body. It is involved in various metabolic processes, including the urea cycle and the synthesis of other amino acids. Additionally, it serves as a neurotransmitter in the central nervous system, influencing neuronal signaling. The substance is soluble in water, which facilitates its biological functions. Its CAS number, 542-07-4, is used for identification in chemical databases and regulatory contexts. Overall, L-aspartic acid is vital for numerous physiological functions and is commonly found in dietary proteins.
Formula:C4H6N2O4
InChI:InChI=1S/C4H6N2O4/c5-4(10)6-2(7)1-3(8)9/h1H2,(H,8,9)(H3,5,6,7,10)
InChI key:InChIKey=UCUUMUFWVSUBOL-UHFFFAOYSA-N
SMILES:C(C(NC(N)=O)=O)C(O)=O
Synonyms:- Urea, (carboxyacetyl)-
- Malonuric acid
- Propanoic acid, 3-[(aminocarbonyl)amino]-3-oxo-
- Malonamic acid, N-carbamoyl-
- 3-[(Aminocarbonyl)amino]-3-oxopropanoic acid
- UCUUMUFWVSUBOL-UHFFFAOYSA-N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Malonuric Acid
CAS:Controlled ProductApplications Malonuric Acid is produced during degradation of sodium barbiturates.
References Fretwurst, F., et al.: Arzneimittel-Forschung, 8, 44-50 (1958)Formula:C4H6N2O4Color and Shape:NeatMolecular weight:146.1
