CAS 54208-72-9
:α-[[(1,1-Dimethylethyl)amino]methyl]-2,2-dimethyl-4H-1,3-benzodioxin-6-methanol
Description:
α-[[(1,1-Dimethylethyl)amino]methyl]-2,2-dimethyl-4H-1,3-benzodioxin-6-methanol, with the CAS number 54208-72-9, is a chemical compound characterized by its complex structure, which includes a benzodioxin core and an amino group. This compound typically exhibits properties associated with organic amines, such as basicity and the ability to form hydrogen bonds due to the presence of hydroxyl (-OH) and amino (-NH) functional groups. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, particularly due to the presence of the dimethylamino group, which can enhance solubility and bioactivity. The compound may also display specific reactivity patterns typical of benzodioxins, including potential for electrophilic substitution reactions. Additionally, its stability and solubility in various solvents can vary based on the functional groups present. Overall, this compound's unique structural features contribute to its potential utility in various chemical applications, although specific reactivity and interaction profiles would require further empirical investigation.
Formula:C16H25NO3
InChI:InChI=1S/C16H25NO3/c1-15(2,3)17-9-13(18)11-6-7-14-12(8-11)10-19-16(4,5)20-14/h6-8,13,17-18H,9-10H2,1-5H3
InChI key:InChIKey=FNNNRZNBSYVOCP-UHFFFAOYSA-N
SMILES:CC1(C)OC=2C(=CC(C(CNC(C)(C)C)O)=CC2)CO1
Synonyms:- 2-(tert-Butylamino)-1-(2,2-dimethyl-4H-benzo[d][1,3]dioxin-6-yl)ethan-1-ol
- 4H-1,3-Benzodioxin-6-methanol, α-[[(1,1-dimethylethyl)amino]methyl]-2,2-dimethyl-
- α-[[(1,1-Dimethylethyl)amino]methyl]-2,2-dimethyl-4H-1,3-benzodioxin-6-methanol
- Salbutamol acetonide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Salbutamol Acetonide
CAS:Controlled Product<p>Applications Salbutamol Acetonide is a Salbutamol (A514500) derivative. It has higher lipophilicity than Salbutamol, which allows an increase of the incorporation efficiency into solid lipid microparticles (SLMs) drug carrier system.<br>References Jaspart, S. et al.: Eur. J. Pharm. Biopharm., 65, 47 (2007)<br></p>Formula:C16H25NO3Color and Shape:NeatMolecular weight:279.37Salbutamol acetonide
CAS:<p>Salbutamol acetonide is a drug substance that belongs to the class of beta-adrenergic receptor agonists and is used as a bronchodilator. It is a prodrug that is hydrolyzed in vivo to salbutamol, its active form. The physicochemical properties of this drug are important for its use in inhalation therapy because it must be delivered as a dry powder or in solid dispersions for maximal efficacy. Salbutamol acetonide can also be formulated into microparticles or particles with different sizes, which may alter the release rate of the drug and potentially provide therapeutic benefits.<br>Salbutamol acetonide has been shown to decrease inflammation, smooth muscle cell proliferation, and mucus hypersecretion in animal experiments. This drug has been used as an endpoint marker in vitro and strategies have been developed to determine the optimal dose of salbutamol acetonide for human use.</p>Formula:C16H25NO3Purity:Min. 95%Molecular weight:279.37 g/mol



