CymitQuimica logo

CAS 5421-06-7

:

5-ethyl-2-(furan-2-yl)-4-propyl-1,3-dioxane

Description:
5-Ethyl-2-(furan-2-yl)-4-propyl-1,3-dioxane is an organic compound characterized by its unique structure, which includes a dioxane ring fused with a furan moiety. The presence of ethyl and propyl substituents contributes to its hydrophobic nature, influencing its solubility and reactivity. This compound is likely to exhibit moderate polarity due to the dioxane ring, which can participate in hydrogen bonding. The furan ring adds aromatic characteristics, potentially enhancing its stability and reactivity in electrophilic aromatic substitution reactions. Additionally, the compound may possess interesting biological activities, making it a candidate for further research in medicinal chemistry. Its CAS number, 5421-06-7, allows for easy identification in chemical databases. Overall, the structural features of 5-ethyl-2-(furan-2-yl)-4-propyl-1,3-dioxane suggest it could have applications in various fields, including pharmaceuticals and materials science, although specific applications would depend on further studies of its properties and interactions.
Formula:C13H20O3
InChI:InChI=1/C13H20O3/c1-3-6-11-10(4-2)9-15-13(16-11)12-7-5-8-14-12/h5,7-8,10-11,13H,3-4,6,9H2,1-2H3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.