CAS 5421-12-5
:4-Methyl-2-nonyl-1,3-dioxolane
Description:
4-Methyl-2-nonyl-1,3-dioxolane is an organic compound characterized by its dioxolane ring structure, which consists of a five-membered ring containing two oxygen atoms. This compound features a nonyl group, indicating a long carbon chain, and a methyl group, which contributes to its branched structure. It is typically a colorless to pale yellow liquid with a distinctive odor. The presence of the dioxolane ring suggests that it may exhibit properties such as moderate polarity and potential solubility in organic solvents. Its molecular structure may impart certain stability and reactivity characteristics, making it useful in various chemical applications, including as a solvent or intermediate in organic synthesis. Additionally, the compound's physical properties, such as boiling point and density, can vary based on its molecular interactions and purity. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C13H26O2
InChI:InChI=1S/C13H26O2/c1-3-4-5-6-7-8-9-10-13-14-11-12(2)15-13/h12-13H,3-11H2,1-2H3
InChI key:InChIKey=SJLDHKPBFAHHSI-UHFFFAOYSA-N
SMILES:C(CCCCCCCC)C1OCC(C)O1
Synonyms:- NSC 6643
- Decanal propylene glycol acetal
- 4-Methyl-2-nonyl-1,3-dioxolane
- 4-Methyl-2-nonyl-1,3-dioxolane
- Decanal, propylene glycol acetal
- AI3-22559
- NSC 6643
- 1,3-Dioxolane, 4-methyl-2-nonyl-
- 2-Nonyl-4-methyl-1,3-dioxolane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Decanal propylene glycol acetal
CAS:<p>Decanal propylene glycol acetal is a biochmecal.</p>Formula:C13H26O2Color and Shape:SolidMolecular weight:214.34
