CAS 5421-79-4
:4,4',4''-propane-1,2,3-triyltripyridine
Description:
4,4',4''-Propane-1,2,3-triyltripyridine, with the CAS number 5421-79-4, is an organic compound characterized by its structure, which consists of a central propane-1,2,3-triyl group bonded to three pyridine rings. Pyridine is a six-membered aromatic ring containing one nitrogen atom, contributing to the compound's potential basicity and aromatic properties. This compound is typically a solid at room temperature and may exhibit solubility in polar organic solvents due to the presence of the nitrogen atoms in the pyridine rings. Its unique structure may impart interesting electronic and steric properties, making it a candidate for applications in coordination chemistry, organic synthesis, and potentially in materials science. The presence of multiple pyridine units can also enhance its ability to form coordination complexes with metal ions, which is of interest in catalysis and the development of functional materials. However, specific physical and chemical properties such as melting point, boiling point, and reactivity would require empirical data for precise characterization.
Formula:C18H17N3
InChI:InChI=1/C18H17N3/c1-7-19-8-2-15(1)13-18(17-5-11-21-12-6-17)14-16-3-9-20-10-4-16/h1-12,18H,13-14H2
SMILES:c1cnccc1CC(Cc1ccncc1)c1ccncc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
