CAS 5422-63-9
:ethyl 4-(formylamino)benzoate
Description:
Ethyl 4-(formylamino)benzoate, with the CAS number 5422-63-9, is an organic compound that belongs to the class of benzoate esters. It features a benzoate moiety with an ethyl group attached to the carboxylate, and a formylamino group at the para position of the aromatic ring. This compound is typically characterized by its moderate solubility in organic solvents and limited solubility in water, which is common for many esters. Ethyl 4-(formylamino)benzoate may exhibit various functional properties, including potential reactivity due to the presence of the formylamino group, which can participate in further chemical reactions such as condensation or nucleophilic attacks. Its structure suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the compound may display biological activity, although specific biological properties would require further investigation. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C10H11NO3
InChI:InChI=1/C10H11NO3/c1-2-14-10(13)8-3-5-9(6-4-8)11-7-12/h3-7H,2H2,1H3,(H,11,12)
SMILES:CCOC(=O)c1ccc(cc1)N=CO
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Ethyl 4-formamidobenzoate
CAS:Formula:C10H11NO3Purity:95%Color and Shape:SolidMolecular weight:193.1992N-Formyl Benzocaine
CAS:Formula:C10H11NO3Color and Shape:White To Off-White SolidMolecular weight:193.20Ethyl 4-Formamidobenzoate (N-Formylbenzocaine)
CAS:Controlled ProductFormula:C10H11NO3Color and Shape:NeatMolecular weight:193.199N-Formyl Benzocaine
CAS:Controlled ProductApplications N-Formyl Benzocaine is a degradation product of Benzocaine (B202970); a compound that is used as an anesthetic (local).
References Kholod, Y., et al.: Environ. Sci. Technol., 43, 9208 (2009); Fliri, A., et al.: J. Med. Chem., 52, 8038 (2009); Helguera, A., et al.: J. Pharm. Sci., 98, 4557 (2009); Onoue, S., et al.: J. Pharm. Sci., 98, 3647 (2009); Koellmer, M., et al.: AAPS PharmSciTech., 14, 1333 (2013)Formula:C10H11NO3Color and Shape:NeatMolecular weight:193.199Ethyl 4-formamidobenzoate
CAS:Formula:C10H11NO3Purity:98%Color and Shape:SolidMolecular weight:193.202






