CAS 54221-95-3
:2-(Acetylamino)isonicotinic acid
Description:
2-(Acetylamino)isonicotinic acid, with the CAS number 54221-95-3, is a chemical compound that belongs to the class of isonicotinic acids, which are derivatives of pyridine. This compound features an acetylamino group attached to the isonicotinic acid structure, contributing to its unique properties. It is typically characterized by its solid state at room temperature and exhibits moderate solubility in polar solvents such as water and alcohols, owing to the presence of both carboxylic acid and amine functional groups. The compound may display biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting various diseases. Its molecular structure allows for potential interactions with biological systems, which can be explored in medicinal chemistry. Additionally, 2-(Acetylamino)isonicotinic acid can participate in various chemical reactions, including acylation and amidation, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C8H8N2O3
InChI:InChI=1/C8H8N2O3/c1-5(11)10-7-4-6(8(12)13)2-3-9-7/h2-4H,1H3,(H,12,13)(H,9,10,11)/p-1
InChI key:InChIKey=VNQIEKXUBYBTPS-UHFFFAOYSA-N
SMILES:N(C(C)=O)C1=CC(C(O)=O)=CC=N1
Synonyms:- 2-(Acetylamino)-4-carboxypyridine
- 2-(Acetylamino)-4-pyridinecarboxylic acid
- 2-Acetamidoisonicotinic acid
- 2-Acetamidopyridine-4-carboxylic acid
- 2-Acetylamino-Isonicotinic Acid
- 4-Pyridinecarboxylic Acid, 2-(Acetylamino)-
- Isonicotinic acid, 2-acetamido-
- 2-(Acetylamino)pyridine-4-carboxylic acid
- 2-acetamido-4-pyridinecarboxylate
- 2-Acetamido-4-pyridinecarboxylic acid
- Zinc02559887
- 2-(Acetylamino)isonicotinic acid 97%
- 2-AECTAMIDO-4-PYRIDINECARBOXYLIC ACID
- 2-(Acetylamino)isonicotinicacid97%
- 2-AcetylaMino-isonic acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Acetylamino-isonicotinic acid
CAS:Formula:C8H8N2O3Purity:95%Color and Shape:SolidMolecular weight:180.16072-(Acetylamino)isonicotinic acid
CAS:2-(Acetylamino)isonicotinic acidFormula:C8H8N2O3Purity:97%Color and Shape: solidMolecular weight:180.16g/mol2-Acetylamino-isonicotinic acid
CAS:Formula:C8H8N2O3Purity:95%Color and Shape:SolidMolecular weight:180.1632-Acetylamino-isonicotinic acid
CAS:2-Acetylamino-isonicotinic acid is a polymerization reaction product of pyridine and vinyl acetate. It is soluble in water, ethanol, and ether. 2-Acetylamino-isonicotinic acid has been used as a template for the synthesis of silver nanoparticles. These particles have shown to be effective against gram positive bacteria such as Staphylococcus aureus and Mycobacterium tuberculosis. The supramolecular assembly of these nanoparticles was achieved using an ion exchange membrane as the template. This assembly leads to the formation of hierarchically organized, porous structures with high surface area that are able to adsorb molecules at their surface.
Formula:C8H8N2O3Purity:Min. 95%Molecular weight:180.16 g/mol



