CAS 54225-86-4

1,3-benzodioxol-5-yl(phenyl)methanone

Description:

1,3-Benzodioxol-5-yl(phenyl)methanone, also known as benzodioxole ketone, is an organic compound characterized by its unique structure that includes a benzodioxole moiety and a phenyl group attached to a carbonyl (ketone) functional group. This compound typically appears as a crystalline solid and is soluble in organic solvents. It exhibits properties common to aromatic compounds, such as stability and potential reactivity due to the presence of the carbonyl group. The benzodioxole structure contributes to its potential biological activity, making it of interest in medicinal chemistry and pharmacology. Additionally, it may serve as a precursor or intermediate in the synthesis of various organic compounds. Its applications can extend to fields such as materials science and organic synthesis, where it may be utilized in the development of dyes, pharmaceuticals, or agrochemicals. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₄H₁₀O₃

InChI: InChI=1/C14H10O3/c15-14(10-4-2-1-3-5-10)11-6-7-12-13(8-11)17-9-16-12/h1-8H,9H2

SMILES: c1ccc(cc1)C(=O)c1ccc2c(c1)OCO2

Synonyms:

• 5-Benzoyl-1,3-benzodioxolane

benzo[d][1,3]dioxol-5-yl(phenyl)methanone

CAS: 54225-86-4

Formula: C₁₄H₁₀O₃

Purity: 95%

Molecular weight: 226.2274

Ref: IN-DA00DCTA

1,3-Benzodioxol-5-yl(phenyl)methanone

Controlled Product

CAS: 54225-86-4

Please enquire for more information about 1,3-Benzodioxol-5-yl(phenyl)methanone including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₄H₁₀O₃

Purity: Min. 95%

Molecular weight: 226.23 g/mol

Ref: 3D-FB123220