CymitQuimica logo

CAS 5423-54-1

:

1,5-Naphthyridin-4-ol

Description:
1,5-Naphthyridin-4-ol, with the CAS number 5423-54-1, is a heterocyclic organic compound characterized by a fused bicyclic structure that includes a pyridine ring and a naphthalene moiety. This compound features a hydroxyl (-OH) group at the 4-position of the naphthyridine ring, which contributes to its chemical reactivity and potential applications. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the hydroxyl group. The compound is of interest in medicinal chemistry and may possess biological activity, making it a candidate for further research in drug development. Its structural features allow for various chemical modifications, which can enhance its pharmacological properties. Additionally, 1,5-Naphthyridin-4-ol can participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, making it a versatile building block in organic synthesis. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C8H6N2O
InChI:InChI=1/C8H6N2O/c11-7-3-5-9-6-2-1-4-10-8(6)7/h1-5H,(H,9,11)
InChI key:NSPLFNGUPLZYHV-UHFFFAOYSA-N
SMILES:c1cc2c(c(=O)cc[nH]2)nc1
Synonyms:
  • 4-Hydroxy-1,5-naphthyridine
  • 1,5-naphthyridin-4(1H)-one
Found 4 products.