CAS 5423-59-6

2-(quinazolin-4-ylamino)ethanol

Description:

2-(Quinazolin-4-ylamino)ethanol, with the CAS number 5423-59-6, is a chemical compound characterized by its quinazoline core structure, which is a bicyclic compound containing a benzene ring fused to a pyrimidine ring. This compound features an amino group attached to the quinazoline moiety and an ethanol group, contributing to its potential as a bioactive molecule. It is typically a white to off-white solid, soluble in polar solvents such as water and alcohols, which enhances its utility in biological applications. The presence of the amino and hydroxyl functional groups suggests that it may participate in hydrogen bonding, influencing its reactivity and interaction with biological targets. 2-(Quinazolin-4-ylamino)ethanol has been studied for its potential pharmacological properties, including anti-cancer and anti-inflammatory activities, making it of interest in medicinal chemistry. As with many organic compounds, its stability and reactivity can be influenced by environmental factors such as pH and temperature.

Formula: C₁₀H₁₁N₃O

InChI: InChI=1/C10H11N3O/c14-6-5-11-10-8-3-1-2-4-9(8)12-7-13-10/h1-4,7,14H,5-6H2,(H,11,12,13)

SMILES: c1ccc2c(c1)c(=NCCO)[nH]cn2

Synonyms:

• Ethanol, 2-(4-Quinazolinylamino)-
• 2-(Quinazolin-4-ylamino)ethanol

2-[(Quinazolin-4-yl)amino]ethan-1-ol

CAS: 5423-59-6

Versatile small molecule scaffold

Formula: C₁₀H₁₁N₃O

Purity: Min. 95%

Molecular weight: 189.21 g/mol

Ref: 3D-FAA42359