CymitQuimica logo

CAS 54231-35-5

:

3-Fluoro-2-nitropyridine

Description:
3-Fluoro-2-nitropyridine is a heterocyclic organic compound characterized by the presence of both a fluorine atom and a nitro group attached to a pyridine ring. The molecular structure consists of a six-membered aromatic ring containing five carbon atoms and one nitrogen atom, with the fluorine substituent located at the 3-position and the nitro group at the 2-position. This compound typically appears as a yellow to brown solid and is known for its polar nature due to the electronegative fluorine and nitro groups, which can influence its reactivity and solubility in various solvents. It is often used in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. The presence of the nitro group can impart significant electrophilic characteristics, making it a useful precursor for further chemical transformations. Safety data indicates that, like many nitro compounds, it should be handled with care due to potential toxicity and environmental hazards.
Formula:C5H3FN2O2
InChI:InChI=1S/C5H3FN2O2/c6-4-2-1-3-7-5(4)8(9)10/h1-3H
InChI key:InChIKey=IJVFHCSUEBAAOZ-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(F)C=CC=N1
Synonyms:
  • 2-Nitro-3-fluoropyridine
  • 3-Fluoro-2-nitropyridine
  • Pyridine, 3-fluoro-2-nitro-
Found 6 products.