CAS 54232-03-0

6-Chloro-5-methylpyridin-3-ol

Description:

6-Chloro-5-methylpyridin-3-ol is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chlorine atom at the 6-position and a methyl group at the 5-position, along with a hydroxyl group at the 3-position, contributes to its unique chemical properties. This compound is typically a solid at room temperature and is soluble in polar solvents due to the hydroxyl group, which can engage in hydrogen bonding. The chlorine substituent can influence the compound's reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the presence of the hydroxyl group suggests that it may exhibit weak acidic properties. 6-Chloro-5-methylpyridin-3-ol may find applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis, owing to its functional groups that can participate in further chemical transformations. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₆H₆ClNO

InChI: InChI=1/C6H6ClNO/c1-4-2-5(9)3-8-6(4)7/h2-3,9H,1H3

SMILES: Cc1cc(cnc1Cl)O

Synonyms:

• 3-Pyridinol, 6-Chloro-5-Methyl-

6-Chloro-5-methylpyridin-3-ol

CAS: 54232-03-0

Formula: C₆H₆ClNO

Purity: 98%

Color and Shape: Solid

Molecular weight: 143.5709

Ref: IN-DA003GYW

2-Chloro-5-hydroxy-3-methylpyridine

CAS: 54232-03-0

2-Chloro-5-hydroxy-3-methylpyridine

Purity: 98%

Molecular weight: 143.57g/mol

Ref: 54-OR345498

6-Chloro-5-methylpyridin-3-ol

CAS: 54232-03-0

Formula: C₆H₆ClNO

Purity: 98%

Color and Shape: Solid

Molecular weight: 143.57

Ref: 10-F208933