CAS 54232-43-8

6-bromo-5-methoxypyridine-2-carboxylic acid

Description:

6-Bromo-5-methoxypyridine-2-carboxylic acid is a heterocyclic organic compound characterized by its pyridine ring, which is substituted at the 2, 5, and 6 positions. The presence of a bromine atom at the 6-position and a methoxy group at the 5-position contributes to its unique chemical properties. The carboxylic acid functional group at the 2-position imparts acidic characteristics, making it capable of participating in various chemical reactions, such as esterification and amidation. This compound is typically used in pharmaceutical research and development due to its potential biological activity, including antimicrobial and anti-inflammatory properties. Its solubility in polar solvents is influenced by the carboxylic acid group, while the bromine and methoxy substituents can affect its reactivity and interaction with biological targets. Overall, 6-bromo-5-methoxypyridine-2-carboxylic acid serves as a valuable building block in organic synthesis and medicinal chemistry.

Formula: C₇H₆BrNO₃

InChI: InChI=1/C7H6BrNO3/c1-12-5-3-2-4(7(10)11)9-6(5)8/h2-3H,1H3,(H,10,11)

SMILES: COc1ccc(C(=O)O)nc1Br

Synonyms:

• 2-Bromo-3-methoxypyridine-6-carboxylic acid
• 2-Pyridinecarboxylic Acid, 6-Bromo-5-Methoxy-

6-Bromo-5-Methoxy-2-Pyridinecarboxylic Acid

CAS: 54232-43-8

Formula: C₇H₆BrNO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 232.0314

Ref: IN-DA003733

6-Bromo-5-methoxypicolinic acid

CAS: 54232-43-8

6-Bromo-5-methoxypicolinic acid

Purity: 98%

Molecular weight: 232.03g/mol

Ref: 54-OR75988

6-Bromo-5-methoxypyridine-2-carboxylic acid

CAS: 54232-43-8

Formula: C₇H₆BrNO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 232.033

Ref: 10-F065952