CAS 54232-59-6
:9-Oxo-10E,12Z-octadecadienoic acid
Description:
9-Oxo-10E,12Z-octadecadienoic acid, also known as 9-oxo-octadecadienoic acid (9-oxo-ODA), is a fatty acid derivative characterized by its unique structure, which includes a long carbon chain with two double bonds and a ketone functional group. This compound typically features a chain length of 18 carbon atoms, with the double bonds located at the 10th and 12th positions, exhibiting a trans (E) configuration at the 10th position and a cis (Z) configuration at the 12th position. The presence of the ketone group at the 9th carbon contributes to its reactivity and potential biological activity. 9-Oxo-ODA is of interest in various fields, including biochemistry and pharmacology, due to its role in signaling pathways and potential effects on cellular processes. It may also be involved in the metabolism of fatty acids and the regulation of inflammatory responses. As a chemical entity, it is typically studied for its properties and applications in health and disease contexts, particularly in relation to lipid metabolism and cellular signaling mechanisms.
Formula:C18H30O3
InChI:InChI=1S/C18H30O3/c1-2-3-4-5-6-8-11-14-17(19)15-12-9-7-10-13-16-18(20)21/h6,8,11,14H,2-5,7,9-10,12-13,15-16H2,1H3,(H,20,21)/b8-6-,14-11+
InChI key:InChIKey=LUZSWWYKKLTDHU-ZJHFMPGASA-N
SMILES:C(C(/C=C/C=C\CCCCC)=O)CCCCCCC(O)=O
Synonyms:- (10E,12Z)-9-Oxo-10,12-octadecadienoic acid
- (E,Z)-9-Oxo-10,12-octadecadienoic acid
- 10,12-Octadecadienoic acid, 9-oxo-, (10E,12Z)-
- 10,12-Octadecadienoic acid, 9-oxo-, (E,Z)-
- 10,12-Octadecadienoicacid, 9-oxo-, (E,Z)-
- 9-Oxo-10E,12Z-octadecadienoic acid
- 9-Oxo-ODE
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
9-Oxo-10(E),12(Z)-octadecadienoic acid
CAS:Formula:C18H30O3Purity:>97%Color and Shape:SolidMolecular weight:294.439-Oxo-10E,12Z-octadecadienoic acid
CAS:Please enquire for more information about 9-Oxo-10E,12Z-octadecadienoic acid including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C18H30O3Purity:Min. 95%Molecular weight:294.43 g/mol9-OxoODE
CAS:9-OxoODE, formed through the oxidation of the allylic hydroxyl group in both 9(S)-HODE and 9(R)-HODE, is present in rabbit reticulocyte plasma and mitochondrial membranes as both 9- and 13-oxoODEs, constituting approximately 2% of the total linoleate residues. The majority of these oxidized linoleate residues are esterified to membrane lipids.Formula:C18H30O3Color and Shape:SolidMolecular weight:294.4


