CAS 54237-53-5
:6-Bromopyrazin-2-amine
Description:
6-Bromopyrazin-2-amine is a heterocyclic organic compound characterized by the presence of a pyrazine ring substituted with a bromine atom and an amino group. Its molecular structure features a six-membered aromatic ring containing two nitrogen atoms, which contributes to its unique chemical properties. The bromine substituent typically enhances the compound's reactivity, making it useful in various synthetic applications, including medicinal chemistry and material science. The amino group can participate in hydrogen bonding and nucleophilic reactions, further expanding its utility in organic synthesis. This compound is often studied for its potential biological activities, including antimicrobial and antitumor properties. Additionally, its solubility and stability in different solvents can vary, influencing its application in research and industry. As with many brominated compounds, safety precautions should be taken due to potential toxicity and environmental concerns. Overall, 6-Bromopyrazin-2-amine serves as an important building block in the development of pharmaceuticals and agrochemicals.
Formula:C4H4BrN3
InChI:InChI=1/C4H4BrN3/c5-3-1-7-2-4(6)8-3/h1-2H,(H2,6,8)
SMILES:c1c(Br)nc(cn1)N
Synonyms:- 2-Amino-6-bromopyrazine
- 2-Pyrazinamine, 6-bromo-
- 54237-53-5
- 6-Bromo-2-pyrazinamine
- 6-Bromopyrazinamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ref: IN-DA003731
1g56.00€5g114.00€10g161.00€1kgTo inquire25g529.00€100gTo inquire100mg28.00€250mg31.00€2-Amino-6-bromopyrazine
CAS:2-Amino-6-bromopyrazine is a versatile building block that can be used in the synthesis of complex compounds. It is also used as a reagent, speciality chemical and useful scaffold for the synthesis of pharmaceuticals and other chemicals. 2-Amino-6-bromopyrazine is available from Sigma Aldrich with CAS No. 54237-53-5.
Formula:C4H4BrN3Purity:Min. 95%Color and Shape:White PowderMolecular weight:174 g/mol



