CAS 5424-01-1
:3-Amino-2-pyrazinecarboxylic acid
Description:
3-Amino-2-pyrazinecarboxylic acid, also known as 3-amino-2-pyrazinecarboxylic acid, is an organic compound characterized by its pyrazine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH) attached to the pyrazine ring, contributing to its properties as an amino acid derivative. It is typically a white to off-white crystalline solid that is soluble in water due to the presence of the polar carboxylic acid and amino groups. The compound exhibits both acidic and basic properties, allowing it to participate in various chemical reactions, including peptide bond formation. Its unique structure makes it of interest in pharmaceutical and agricultural chemistry, where it may serve as a building block for more complex molecules or as a potential bioactive agent. Additionally, it can be used in research related to nitrogen-containing heterocycles and their applications in medicinal chemistry.
Formula:C5H5N3O2
InChI:InChI=1S/C5H5N3O2/c6-4-3(5(9)10)7-1-2-8-4/h1-2H,(H2,6,8)(H,9,10)
InChI key:InChIKey=ZAGZIOYVEIDDJA-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(N)=NC=CN1
Synonyms:- 2-Amino-3-carboxypyrazine
- 2-Aminopyrazine-3-carboxylic acid
- 2-Pyrazinecarboxylic acid, 3-amino-
- 3-Amino-2-pyrazinecarboxylic acid
- 3-Amino-2-pyrazinoic acid
- 3-Aminopyrazine-2-Carboxylate
- 3-Aminopyrazinecarboxylic acid
- Ai3-61137
- Nsc 13148
- Nsc 225114
- Pyrazinecarboxylic acid, 3-amino-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
3-Aminopyrazine-2-carboxylic Acid
CAS:Formula:C5H5N3O2Purity:>98.0%(T)(HPLC)Color and Shape:White to Amber powder to crystallineMolecular weight:139.113-Aminopyrazine-2-carboxylic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C5H5N3O2Purity:98%Color and Shape:Pale brown to brown, Crystals or powder or crystalline powderMolecular weight:139.113-Aminopyrazine-2-carboxylic acid
CAS:Formula:C5H5N3O2Purity:98%Color and Shape:SolidMolecular weight:139.11213-Aminopyrazine-2-carboxylic acid
CAS:3-Aminopyrazine-2-carboxylic acidFormula:C5H5N3O2Purity:98%Color and Shape: light grey solidMolecular weight:139.11g/mol3-Amino-2-pyrazinecarboxylic Acid
CAS:Controlled ProductApplications Antidiabetic.
References A-Rahim, Y.I., et al.: Phararmcology 52, 145 (1996),Formula:C5H5N3O2Color and Shape:NeatMolecular weight:139.113-Aminopyrazine-2-carboxylic acid
CAS:Formula:C5H5N3O2Purity:98%Color and Shape:SolidMolecular weight:139.1143-Amino-2-pyrazinecarboxylic acid
CAS:3-Amino-2-pyrazinecarboxylic acid (APC) is a molecule that has been studied from many different theoretical perspectives. It has been shown to have magnetic, vibrational and spectroscopic properties. APC has a molecular electrostatic potential that can be calculated by the functional theory of atoms in molecules. This theory predicts the distribution of electron density between atoms in molecules and is used to identify which parts of a molecule are more likely to react with other molecules. The Raman spectra of APC show an intense peak at 1108 cm-1 and two weak peaks at 1265 cm-1 and 1403 cm-1. The frequency of these peaks corresponds to a bond length of 1.3 Å, 1.5 Å, and 1.7 Å respectively, corresponding to π bonds in benzene rings, σ bonds and π bonds in amide groups respectively, or σ bonds in amide groups respectively.Formula:C5H5N3O2Purity:Min. 95%Color and Shape:PowderMolecular weight:139.11 g/mol









